| Name | ethyl 2-ethylbutyrate |
| Synonyms | RARECHEM AL BI 0134 ethyl 2-ethylbutyrate ETHYL 2-ETHYLBUTYRATE Ethyl 2-ethylbutanoate ethyl 2-ethylbutanoate 2-ethyl-butanoicaciethylester 2-ETHYLBUTYRIC ACID ETHYL ESTER 2-Ethyl-n-butyric acid ethyl ester 2-ETHYL-N-BUTYRIC ACID ETHYL ESTER Butanoic acid, 2-ethyl-, ethyl ester |
| CAS | 2983-38-2 |
| EINECS | 221-044-9 |
| InChI | InChI=1/C8H16O2/c1-4-7(5-2)8(9)10-6-3/h7H,4-6H2,1-3H3 |
| Molecular Formula | C8H16O2 |
| Molar Mass | 144.21 |
| Density | 0,87 g/cm3 |
| Melting Point | 149-152°C |
| Boling Point | 152°C |
| Flash Point | 39°C |
| Vapor Presure | 2.91mmHg at 25°C |
| Appearance | clear liquid |
| Color | Colorless to Almost colorless |
| Storage Condition | Room Temprature |
| Refractive Index | 1.4030 to 1.4050 |
| MDL | MFCD00059396 |
| Risk Codes | 10 - Flammable |
| Safety Description | 16 - Keep away from sources of ignition. |
| UN IDs | 3272 |
| Hazard Class | 3 |
| Packing Group | III |
| FEMA | 4344 | ETHYL 2-ETHYLBUTYRATE |